![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Transformingthesuppl..> | 2001-01-23 15:25 | 70K | |
| TheValueEquation.doc | 2001-01-04 13:51 | 468K | |
| The Fight for Lingua..> | 2001-01-04 14:15 | 85K | |
| SupplyChainManagement/ | 2012-05-04 17:39 | - | |
| Supply-chain mgt and..> | 2001-01-23 14:56 | 27K | |
| RiseandFalloftheTrad..> | 2001-01-04 14:04 | 812K | |
| RevengeoftheBricks.mht | 2001-01-04 14:24 | 92K | |
| OldDogsLearnNewTrick..> | 2001-01-23 15:18 | 58K | |
| FightforLinguaFranca..> | 2001-01-04 14:15 | 85K | |
| EBusinessTransformat..> | 2001-01-04 10:24 | 142K | |
| DangerousLiaisons.mht | 2001-01-23 15:23 | 88K | |
| Dangerous Liaisons.mht | 2001-01-23 15:23 | 88K | |
| Chemical uppliersaim..> | 2001-01-04 10:29 | 131K | |
| BigThreeautomakersbi..> | 2001-01-04 10:32 | 58K | |
| Beyond the Exchange ..> | 2001-01-23 15:29 | 76K | |
| B2Bexchangesarmforfo..> | 2001-01-04 10:30 | 128K | |
| B2BPrivateEmarketpla..> | 2001-01-20 11:23 | 1.2M | |
| B-2-B Private E-mark..> | 2001-01-20 11:23 | 1.2M | |